Dioxaphetyl Butyrate

drugbox
IUPAC_name = ethyl 4-morpholin-4-yl-2,2-di(phenyl)butanoate

---

width = 180
CAS_number = 467-86-7
synonyms = Dioxaphetyl Butyrate, Amidalgon, Spasmoxal
ATC_prefix =
ATC_suffix =
PubChem = 48194
smiles = CCOC(=O)C(CCN1CCOCC1)(c1ccccc1)c1ccccc1
DrugBank =
C = 22 | H = 27 | N = 1 | O = 3
molecular_weight = 353.45 g/mol
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

Dioxaphetyl Butyrate (Amidalgon, Spasmoxal) is an opioid analgesic which is a diphenylacetic acid derivative, related to other drugs such as dextropropoxyphene.

It produces similar effects to other opioids, including analgesia, sedation, dizziness and nausea.

References