Imidazol-4-one-5-propionic acid

Imidazol-4-one-5-propionic acid

Chembox new
ImageFile=Imidazol-4-one-5-propionic acid.pngImageSize=200px
IUPACName=3-(5-Oxo-1,4-dihydroimidazol-4-yl)propanoic acid
OtherNames=
Section1= Chembox Identifiers
CASNo=17340-16-8
PubChem=128
SMILES=C1=NC(C(=O)N1)CCC(=O)O
MeSHName=Imidazol-4-one-5-propionic+acid

Section2= Chembox Properties
Formula=C6H8N2O3
MolarMass=156.139
Appearance=
Density=
MeltingPt=
BoilingPt=
Solubility=

Section3= Chembox Hazards
MainHazards=
FlashPt=
Autoignition=

Imidazol-4-one-5-propionic acid is an intermediate in the metabolism of histidine.

ee also

* Urocanate hydratase
* Urocanate
* Formiminoglutamic acid


Wikimedia Foundation. 2010.

См. также в других словарях:


Поделиться ссылкой на выделенное

Прямая ссылка:
Нажмите правой клавишей мыши и выберите «Копировать ссылку»