Ganesha (psychedelic)

Chembox new
ImageFileL1 = ganesha_chem.png ImageSizeL1 = 120px
ImageFileR1 = Ganesha3d.png ImageSizeR1 = 100px
IUPACName = 2-(2,5-Dimethoxy-3,4-dimethyl-phenyl)-1-methyl-ethylamine
OtherNames = 3,4-Dimethyl-2,5-dimethoxyamphetamine;
2-(3,4-Dimethyl-2,5-dimethoxyphenyl)-1-methyl-1-aminoethane
Section1 = Chembox Identifiers
CASNo = 207740-37-2
PubChem =
SMILES = NC(C)CC1=C(OC)C(C)=C(C)C(OC)=C1
Section2 = Chembox Properties
Formula = C₁₃H₂₁NO₂
MolarMass = 223.31 g·mol⁻¹
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

Ganesha, or 2,5-dimethoxy-3,4-dimethylamphetamine, or 3C-G, is a lesser-known psychedelic drug. It is also a substituted amphetamine. It was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the dosage range is listed as 24-32mg. Ganesha is sold in the form of dark red crystals. The drug is usually taken orally, although other routes such as rectally may also be used. Ganesha is synthesized from 2,5-dimethoxy-3,4-dimethylbenzaldehyde. Ganesha is the amphetamine analogue of 2C-G. It is a particularly long lasting drug, with the duration listed in PiHKAL as being 18 - 24 hours, which might make it undesirable to some users. It is named after the Hindu deity, Ganesha. Very little data is known about the dangers or toxicity of Ganesha. Effects of Ganesha include:

* Strong closed-eye visuals
* An increased appreciation of music
* Powerful relaxation and tranquility

Homologues

3C-G-3

"Dosage": 12-18 mg

"Duration": 8-12 h

"Effects": Enhancement of reading, no visuals or body load.

"2C analog": 2C-G-3

3C-G-4

"Dosage": unknown

"Duration": unknown

"Effects": unknown

"2C analog": 2C-G-4

3C-G-5

"Dosage": 14-20 mg

"Duration": 16-30 h

"2C analog": 2C-G-5

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants
* 2C-G
* Ganesha, the Indian deity

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal085.shtml Ganesha Entry in "PiHKAL"]