Fasoracetam

Chembox new
ImageFileL1 = Fasoracetam.png ImageSizeL1 = 100px
ImageFileR1 = Fasoracetam3d.png ImageSizeR1 = 110px
IUPACName = (5R)-5-(piperidine-1-carbonyl) pyrrolidin-2-one
OtherNames =
Section1 = Chembox Identifiers
PubChem = 198695
CASNo =110958-19-5
ATCCode_prefix =
ATCCode_suffix =
SMILES= C1CCN(CC1)C(=O)C2CCC(=O)N2
Section2 = Chembox Properties
Formula = | C=10 | H=16 | N=2 | O=2
MolarMass = 196.246 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section5 = Chembox Pharmacology
AdminRoutes = Oral
Bioavail =
Metabolism =
HalfLife =
ProteinBound =
Excretion =
Legal_status =
Legal_US =
Legal_UK =
Legal_AU =
Legal_CA =
PregCat =
PregCat_AU =
PregCat_US =

Fasoracetam is a nootropic drug of the racetam family.