Ritanserin

drugbox
IUPAC_name = 6- [2- [4- [bis(4-fluorophenyl)methylidene] piperidin-1-yl] ethyl] -7-methyl- [1,3] thiazolo [2,3-b] pyrimidin-5-one


width = 180
CAS_number = 87051-43-2
ATC_prefix =
ATC_suffix =
PubChem = 5074
DrugBank =
C = 27 | H = 25 | F = 2 | N = 3 | O = 1 | S = 1
molecular_weight = 477.569 g/mol
smiles = CC1=C(C(=O)N2C=CSC2=N1)CCN3CCC(=C(C4=CC=C(C=C4)F)C5=CC=C(C=C5)F)CC3
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

Ritanserin is a serotonin antagonist with wide-reaching possibilities for the treatment of many neurological disorders.When used together with typical antipsychotics in the treatment of schizophrenia is able to decrease negative symptoms and adds some "atypicality" as parkinsonism is slightly decreased.

Pharmacology

Ritanserin is a potent and long-acting 5-HT₂ receptor antagonist ("Ki" = 0.39 nM). It has anxiolytic effects "in vivo".