Prodilidine

drugbox
IUPAC_name = (1,2-dimethyl-3-phenylpyrrolidin-3-yl) propanoate


width = 240
CAS_number = 3734-17-6
synonyms = Prodilidine
ATC_prefix =
ATC_suffix =
PubChem = 19514
DrugBank =
C = 15 | H = 21 | N = 1 | O = 2
molecular_weight = 247.333 g/mol
smiles = CCC(=O)OC1(CCN(C1C)C)C2=CC=CC=C2
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

Prodilidine is an opioid analgesic which is a ring-contracted analogue of prodine. It has around the same efficacy as codeine, but is only around 1/3rd the potency, and has little abuse potential. [ [http://www.unodc.org/unodc/en/data-and-analysis/bulletin/bulletin_1964-01-01_1_page005.html Fraser HF. Addictiveness of 1,2-dimethyl,3-phenyl,3-propionoxy pyrrolidine hydrochloride (ARC I-O-1) "UNODC Bulletin on Narcotics" 1964 Issue 1.] ] [Splitter SR. Treatment of pain in patients with a new nonnarcotic analgesic, prodilidine hydrochloride (Cogesic). "Current Therapeutic Research, Clinical and Experimental". 1961 Nov;3:472-7. PMID 13915874] [Kissel JW, Albert JR, Boxill GC. The pharmacology of prodilidine hydrochloride, a new analgetic agent. "Journal of Pharmacology and Experimental Therapeutics". 1961 Dec;134:332-40. PMID 14456453] [Weikel JH Jr, Labudde JA. Absorption, excretion and fate of prodilidine. "Journal of Pharmacology and Experimental Therapeutics". 1962 Dec;138:392-8. PMID 13999550] [Batterman RC, Mouratoff GJ, Kaufman JE. Prodilidine Hydrochloride: A new moderately potent analgesic. "American Journal of the Medical Sciences". 1964 Jan;247:62-8. PMID 14106881]

References