Eleostearic acid

Chembox new
Name = α-Eleostearic acid
ImageFile = Alpha-eleostearic acid.svg
ImageName = α-Eleostearic acid
IUPACName = (9E,11E,13Z)-octadeca-9,11,13-trienoic acid
Section1 = Chembox Identifiers
SMILES = CCCCC=C/C=C/C=C/CCCCCCCC(=O)O
Section2 = Chembox Properties
Formula = C₁₈H₃₀O₂
MolarMass = 278.43 g/mol
MeltingPt = 48 °Ccite journal
author=Burr, G.O.; Burr, M.M.; Miller, E.|year=1932
url=http://www.jbc.org/cgi/reprint/97/1/1.pdf |accessdate=2007-01-17
title= On the nature and role of the fatty acids essential in nutrition
journal=J. Biol. Chem. | volume=97 | issue = 1 | pages = 1–9]

Eleostearic acid, (ELA) sometimes called α-eleostearic acid, is a conjugated linolenic acid (CLnA). It makes up approximately 80% of the fatty acids in tung oil and 60% of bitter gourd oil. Its high degree of unsaturation gives tung oil its properties as a drying oil. In rats, it is converted to a conjugated linoleic acid (CLA).cite journal
url= http://jn.nutrition.org/cgi/content/abstract/136/8/2153 |pmid= 16857834
journal= J Nutr|year=2006 |month=Aug|volume=136|issue=8|pages=2153–9.
title= Conjugated linolenic acid is slowly absorbed in rat intestine, but quickly converted to conjugated linoleic acid
author=Tsuzuki T, Kawakami Y, Abe R, "et al"|accessdate=2007-01-17] In their pioneering work on essential fatty acids, Burr, Burr and Miller compared the nutritional properties of ELA to that of its isomer alpha-linolenic acid (ALA). ALA relieved essential fatty acid deficiency; ELA did not.

The closely related isomer β-eleostearic acid is (9E,11E,13E)-octadeca-9,11,13-trienoic acid.

References