List of biomolecules

List of biomolecules

This page aims to list articles on Wikipedia that describe particular biomolecules or types of biomolecules.

This list is not necessarily complete or up to date - if you see an article that should be here but isn't (or one that shouldn't be here but is), please update the page accordingly.

"See also:" Chemical compound, Organic compound, biochemistry.

"Similar lists:" List of compounds, List of organic compounds, List of proteins

__NOTOC__

A

For substances with an A- or α- prefix such as
α-amylase, please see the parent page (in this case Amylase).

* A23187 (Calcimycin, Calcium Ionophore)
* Abamectin
* Abietic acid
* Acetic acid
* Acetylcholine
* Actin
* Actinomycin D
* Adenosine
* Adenosine diphosphate (ADP)
* Adenosine monophosphate (AMP)
* Adenosine triphosphate (ATP)
* Adenylate cyclase
* Adonitol
* Adrenaline, epinephrine
* Adrenocorticotropic hormone (ACTH)
* Aequorin
* Aflatoxin
* Agar
* Alamethicin
* Alanine
* Albumins
* Aldosterone
* Aleurone
* Alpha-amanitin
* Allantoin
* α-Amanatin, see Alpha-amanitin
* Amino acid
* Anabolic steroid
* Anethole
* Angiotensinogen
* Amylase (also see α-amylase)
* Angiotensinogen
* Anisomycin
* Antidiuretic hormone (ADH)
* Arabinose
* Arginine
* Ascomycin
* Ascorbic acid (vitamin C)
* Asparagine
* Aspartic acid
* Asymmetric dimethylarginine
* Atrial-natriuretic peptide (ANP)
* Auxin
* Azadirachtin A – C35H44O16

B

*Bacteriocin
*Beauvericin
*Bicuculline
*Bilirubin
*Biopolymer
*Biotin (Vitamin H)
*Brefeldin A
*Brucine

C

* Cadaverine
* Caffeine
* Calciferol (Vitamin D)
* calcitonin
* Calmodulin
* Calmodulin
* Calreticulin
* Camphor
* Cannabinol
* Capsaicin
* Carbohydrase
* Carbohydrate
* Carnitine
* Carrageenan
* Casein
* Caspase
* Cellulase
* Cellulose
* Cerulenin
* Chelerythrine
* Chromomycin A3
* Chaparonin
* Chitin
* α-Chloralose
* Chlorophyll
* Cholecystokinin (CCK)
* Cholesterol
* Choline
* Chondroitin sulfate
* Cinnamaldehyde
* Citral
* Citric acid
* Citrinin
* Citronellal
* Citronellol
* Citrulline
* Cobalamin (Vitamin B12)
* Coenzyme
* Coenzyme Q
* Colchicine
* Collagen
* Coniine
* Corticosteroid
* Corticosterone
* Corticotropin-releasing hormone (CRH)
* Cortisol
* Creatine
* Creatine kinase
* Crystallin
* α-Cyclodextrin
* Cyclodextrin glycosyltransferase
* Cyclopamine
* Cyclopiazonic acid
* Cysteine
* Cystine
* Cytidine
* Cytochalasin
* Cytochalasin E
* Cytochrome
* Cytochrome C
* Cytochrome c oxidase
* Cytochrome c peroxidase
* Cytokine
* Cytosine – C4H5N3O

D

*Deoxycholic acid
*DON (DeoxyNivalenol)
*Deoxyribofuranose
*Deoxyribose
*Deoxyribose nucleic acid (DNA)
*Dextran
*Dextrin
*DNA
*Dopamine

E

*Enzyme
*Ephedrine
*Epinephrine – C9H13NO3
*Erucic acid – CH3(CH2)7CH=CH(CH2)11COOH
*Erythritol
*Erythropoietin (EPO)
*Estradiol
*Eugenol

F

* Fatty acid
* Fibrin
* Fibronectin
* Folic acid (Vitamin M)
* Follicle stimulating hormone (FSH)
* Formaldehyde
* Formic acid
* Forskolin
* Fructose
* Fumonisin B1
* Fumonisin B2

G

*Gamma globulin
*Galactose
*Gamma globulin
*Gamma-aminobutyric acid
*Gamma-butyrolactone
*Gamma-hydroxybutyrate (GHB)
*Gastrin
*Gelatin
*Geraniol
*Globulin
*Glucagon
*Glucosamine
*Glucose – C6H12O6
*Glucose oxidase
*Gluten
*Glutamic acid
*Glutamine
*Glutathione
*Gluten
*Glycerin (glycerol)
*Glycine
*Glycogen
*Glycolic acid
*Glycolipid
*Glycoprotein
*Gonadotropin-releasing hormone (GnRH)
*Granzyme
*Green fluorescent protein
*Growth hormone
*Growth hormone-releasing hormone (GHRH)
*GTPase
*Guanine
*Guanosine
*Guanosine triphosphate (+GTP)

H

*Haptoglobin

*Hematoxylin
*Heme
*Hemerythrin
*Hemocyanin
*Hemoglobin
*Hemoprotein
*Heparan sulfate
*High density lipoprotein, HDL
*Histamine
*Histidine
*Histone
*Histone methyltransferase
*HLA antigen
*Homocysteine
*Hormone
*human chorionic gonadotropin (hCG)
*Human growth hormone
*Hyaluronate
*Hyaluronidase
*Hydrogen peroxide
*Hydroxyproline
*5-Hydroxytryptamine

I

*Indigo
*Indole
*Inosine
*Inositol
*Insulin
*Insulin-like growth factor
*Integral membrane protein
*Integrase
*Integrin
*Intein
*Interferon
*Inulin
*Ionomycin
*Ionone
*Isoleucine
*Iron-sulfur cluster

J

K

*K252a
*K252b
*KT5720
*KT5823
*Keratin
*Kinase

L

For substances with an l- or L- prefix such as L-alanine or DL-alanine, please see the parent page (in this case alanine).

*Lactase
*Lactic acid
*Lactose
*Lanolin
*Lauric acid
*Leptin
*Leptomycin B
*Leucine
*Lignin
*Limonene
*Linalool
*Linoleic acid
*Linolenic acid
*Lipase
*Lipid
*Lipid anchored protein
*Lipoamide
*Lipoprotein
*Low density lipoprotein,LDL
*Luteinizing hormone (LH)
*Lycopene
*Lysine
*Lysozyme

M

*Malic acid
*Maltose
*Melatonin
*Membrane protein
*Metalloprotein
*Metallothionein
*Methionine
*Mimosine
*Mithramycin A
*Mitomycin C
*Monomer
*Mycophenolic acid
*Myoglobin
*Myosin

N

None

O

*Ochratoxin A
*Oestrogens
*Oligopeptide
*Oligomycin
*Orcin
*Orexin
*Ornithine
*Oxalic acid
*Oxidase
*Oxytocin

P

*p53
*PABA
*Paclitaxel
*Palmitic acid
*Pantothenic acid (Vitamin B5)
*parathyroid hormone (PTH)
*Paraprotein
*Pardaxin
*Parthenolide
*Patulin
*Paxilline
*Penicillic acid
*Penicillin
*Penitrem A
*Peptidase
*Pepsin
*Peptide
*Peripheral membrane protein
*Phenethylamine
*Phenylalanine
*Phosphagen
*phosphatase
*Phospholipid
*Phenylalanine
*Phytic acid
*Plant hormones
*Polypeptide
*Polyphenol
*Polysaccharide
*Porphyrin
*Prion
*Progesterone
*Prolactin (PRL)
*Proline
*Propionic acid
*Protamine
*Protease
*Protein
*Proteinoid
*Putrescine
*Pyrethrin
*Pyridoxine or pyridoxamine (Vitamin B6)
*Pyrrolysine
*Pyruvic acid

Q

*Quinone

R

*Radicicol
*Raffinose
*Renin
*Retinene
*Retinol (Vitamin A)
*Rhodopsin (visual purple)
*Riboflavin (Vitamin B2)
*Ribofuranose, Ribose
*Ricin
*RNA - Ribonucleic acid
*RuBisCO

S

* Safrole
* Salicylaldehyde
* Salicylic acid
* Salvinorin-A – C23H28O8
* Saponin
* Secretin
* Selenocysteine
* Selenomethionine
* Selenoprotein
* Serine
* Serine kinase
* Serotonin
* Skatole
* Signal recognition particle
* Somatostatin
* Sorbic acid
* Squalene
* Staurosporin
* Stearic acid
* Sterigmatocystin
* Sterol
* Strychnine
* Sucrose (sugar)
* Sugars (in general)
* superoxide

T

*T2 Toxin
*Tannic acid
*Tannin
*Tartaric acid
*Taurine
*Tetrodotoxin
*Thaumatin
*Topoisomerase
*Tyrosine kinase
*Taurine
*Testosterone
*Tetrodotoxin
*Thapsigargin
*Thaumatin
*Thiamine (Vitamin B1) – C12H17ClN4OS·HCl
*Threonine
*Thrombopoietin
*Thymidine
*Thymine
*Thiamine (Vitamin B1)
*Triacsin C
*Thyroid-stimulating hormone (TSH)
*Thyrotropin-releasing hormone (TRH)
*Thyroxine (T4)
*Tocopherol (Vitamin E)
*Topoisomerase
*Triiodothyronine (T3)
*Transmembrane receptor
*Trichostatin A
*Trophic hormone
*Trypsin
*Tryptophan
*Tubulin
*Tunicamycin
*Tyrosine

U

* Ubiquitin
* Uracil
* Urea
* Urease
* Uric acid – C5H4N4O3
* Uridine

V

* Valine
* Valinomycin
* Vanabins
* Vasopressin
* Verruculogen
* Vitamins (in general)
* Vitamin A (retinol)
* Vitamin B ()
** Vitamin B1 (thiamine)
** Vitamin B2 (riboflavin)
** Vitamin B3 (niacin or nicotinic acid)
** Vitamin B4 (adenine)
** Vitamin B5 (pantothenic acid)
** Vitamin B6 (pyridoxine or pyridoxamine)
** Vitamin B12 (cobalamin)
* Vitamin C (ascorbic acid)
* Vitamin D (calciferol)
* Vitamin E (tocopherol)
* Vitamin F
* Vitamin H (biotin)
* Vitamin K (naphthoquinone)
* Vitamin M (folic acid)
* Vitamin P (niacin or nicotinic acid)
* Vitamin S

W

* Water
* Wortmannin

X

* Xylose

Y

Z

* Zearalenone


Wikimedia Foundation. 2010.

Игры ⚽ Нужен реферат?

Look at other dictionaries:

  • List of chemistry topics — This page aims to list articles related to chemistry. This is so that those interested in the subject can monitor changes to the pages by clicking on Related Changes in the sidebar and on the bottom of the page.This list is not necessarily… …   Wikipedia

  • List of organic compounds — This page aims to list well known organic compounds, including organometallic compounds, to stimulate the creation of Wikipedia articles. Note that purely inorganic compounds, minerals, and chemical elements are not included on this list. There… …   Wikipedia

  • List of science topics — This is a list of topics in various sciences. Astronomy *List of basic astronomy topics *Asteroids *List of constellations **...by area *List of meteor showers *List of stars **List of nearest stars **List of brightest stars **List of most… …   Wikipedia

  • List of biochemistry topics — This page aims to list articles on Wikipedia that are related to biochemistry. This is so that those interested in the subject can monitor changes to the pages by clicking on .This list is not necessarily complete or up to date if you see an… …   Wikipedia

  • List of compounds — The original list from this page has been split into the following three lists, as the number of compounds became too long. Please see the appropriate list: * List of inorganic compounds, compounds without a C H bond * List of organic compounds,… …   Wikipedia

  • List of fungicides — This page aims to list well known chemical compounds, to stimulate the creation of Wikipedia articles.This list is not necessarily complete or up to date ndash; if you see an article that should be here but isn t (or one that shouldn t be here… …   Wikipedia

  • List of inorganic compounds — Tentative listing related to this page, inorganic compounds by element (presently under construction), as well as . This list is not necessarily complete or up to date ndash; if you see an article that should be here but isn t (or one that… …   Wikipedia

  • List of organic reactions — Well known reactions and reagents in organic chemistry include Contents: A B C D E F G H I J K L M N O P Q R S T U V W X Y Z    See also   Ext …   Wikipedia

  • List of Star Wars planets (M–N) — For the Mirial Company, see Mirial s.u.r.l.. Contents 1 M2398 2 M4 78 3 Malachor V …   Wikipedia

  • List of Star Wars planets (M-N) — M4 78 M4 78 is the name given to a planet colonized by droids. In , it was mentioned that the planet was settled by droids as part of a planetary restoration project, but were sabotaged by the Sith. In removed content from the game, the player,… …   Wikipedia

Share the article and excerpts

Direct link
Do a right-click on the link above
and select “Copy Link”